About 1-ethyl-3-ethylideneurea
1-ethyl-3-ethylideneurea (PubChem CID 57318340) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 1-ethyl-3-ethylideneurea.
Molecular Properties
| Compound Name | 1-ethyl-3-ethylideneurea |
| PubChem CID | 57318340 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 1-ethyl-3-ethylideneurea |
| SMILES | CC=NC(=O)NCC |
| InChI | InChI=1S/C5H10N2O/c1-3-6-5(8)7-4-2/h3H,4H2,1-2H3,(H,7,8) |
| InChIKey | TXCLFVQSOCNDGK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-ethylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-ethylideneurea?
The IUPAC name of 1-ethyl-3-ethylideneurea (CID 57318340) is 1-ethyl-3-ethylideneurea.
What is the SMILES notation for 1-ethyl-3-ethylideneurea?
The canonical SMILES for 1-ethyl-3-ethylideneurea is CC=NC(=O)NCC.
What is the InChIKey of 1-ethyl-3-ethylideneurea?
The InChIKey is TXCLFVQSOCNDGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-3-6-5(8)7-4-2/h3H,4H2,1-2H3,(H,7,8).
What are the key properties of 1-ethyl-3-ethylideneurea?
1-ethyl-3-ethylideneurea has a molecular weight of 114.15 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-ethylideneurea is sourced from PubChem (CID 57318340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).