About 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene
2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene (PubChem CID 57318345) has the molecular formula C11H18N4O2S
and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene.
Molecular Properties
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene |
| PubChem CID | 57318345 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene |
| SMILES | [H]/N=N/C(CC)C(C)Sc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C11H18N4O2S/c1-5-8(15-12)7(2)18-11-13-9(16-3)6-10(14-11)17-4/h6-8,12H,5H2,1-4H3/b15-12+ |
| InChIKey | BVNJXFSFZLZYRE-NTCAYCPXSA-N |
| XLogP | 2.78 |
| TPSA | 80.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene?
The IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene (CID 57318345) is 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene.
What is the SMILES notation for 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene?
The canonical SMILES for 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene is [H]/N=N/C(CC)C(C)Sc1nc(OC)cc(OC)n1.
What is the InChIKey of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene?
The InChIKey is BVNJXFSFZLZYRE-NTCAYCPXSA-N. The full InChI is InChI=1S/C11H18N4O2S/c1-5-8(15-12)7(2)18-11-13-9(16-3)6-10(14-11)17-4/h6-8,12H,5H2,1-4H3/b15-12+.
What are the key properties of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene?
2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene has a molecular weight of 270.36 g/mol, XLogP of 2.78, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-3-yldiazene is sourced from PubChem (CID 57318345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).