C17H24NO3S+ — CID 57318476
(1S,4R)-2-methyl-4-(4-methylphenyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57318476) has the molecular formula C17H24NO3S+ and a molecular weight of 322.45 g/mol. Its IUPAC name is (1S,4R)-2-methyl-4-(4-methylphenyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1S,4R)-2-methyl-4-(4-methylphenyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57318476 |
| Molecular Formula | C17H24NO3S+ |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (1S,4R)-2-methyl-4-(4-methylphenyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | Cc1ccc([C@H]2CC(C)[N@+](C(=O)O)(C(=O)C(C)CS)C2)cc1 |
| InChI | InChI=1S/C17H23NO3S/c1-11-4-6-14(7-5-11)15-8-13(3)18(9-15,17(20)21)16(19)12(2)10-22/h4-7,12-13,15H,8-10H2,1-3H3,(H-,20,21,22)/p+1/t12?,13?,15-,18-/m0/s1 |
| InChIKey | XLOFHCLKRMIXLP-ZDSIWDHJSA-O |
| XLogP | 3.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|