C19H19NO — CID 57318643
3-(5,6,7,8-tetrahydronaphthalen-2-ylmethylidene)-1,2-dihydroindol-2-ol (PubChem CID 57318643) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-(5,6,7,8-tetrahydronaphthalen-2-ylmethylidene)-1,2-dihydroindol-2-ol.
| Compound Name | 3-(5,6,7,8-tetrahydronaphthalen-2-ylmethylidene)-1,2-dihydroindol-2-ol |
|---|---|
| PubChem CID | 57318643 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-(5,6,7,8-tetrahydronaphthalen-2-ylmethylidene)-1,2-dihydroindol-2-ol |
| SMILES | OC1Nc2ccccc2C1=Cc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H19NO/c21-19-17(16-7-3-4-8-18(16)20-19)12-13-9-10-14-5-1-2-6-15(14)11-13/h3-4,7-12,19-21H,1-2,5-6H2 |
| InChIKey | BOFBDMFMQVPVSW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|