About 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione
1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione (PubChem CID 57319237) has the molecular formula C12H10N8O4
and a molecular weight of 330.26 g/mol. Its IUPAC name is 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione |
| PubChem CID | 57319237 |
| Molecular Formula | C12H10N8O4 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c2c(ncn2-n2cnc3c(=O)[nH]c(=O)n(C)c32)c1=O |
| InChI | InChI=1S/C12H10N8O4/c1-17-9-6(8(21)16-12(17)24)14-4-20(9)19-3-13-5-7(19)15-11(23)18(2)10(5)22/h3-4H,1-2H3,(H,15,23)(H,16,21,24) |
| InChIKey | BGDGHHRFIOQSME-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione?
The IUPAC name of 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione (CID 57319237) is 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione.
What is the SMILES notation for 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione?
The canonical SMILES for 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione is Cn1c(=O)[nH]c2c(ncn2-n2cnc3c(=O)[nH]c(=O)n(C)c32)c1=O.
What is the InChIKey of 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione?
The InChIKey is BGDGHHRFIOQSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N8O4/c1-17-9-6(8(21)16-12(17)24)14-4-20(9)19-3-13-5-7(19)15-11(23)18(2)10(5)22/h3-4H,1-2H3,(H,15,23)(H,16,21,24).
What are the key properties of 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione?
1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione has a molecular weight of 330.26 g/mol, XLogP of -2.53, 1 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-9-(3-methyl-2,6-dioxopurin-9-yl)-3H-purine-2,6-dione is sourced from PubChem (CID 57319237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).