About 3-oxoicosanethioic S-acid
3-oxoicosanethioic S-acid (PubChem CID 57319245) has the molecular formula C20H38O2S
and a molecular weight of 342.59 g/mol. Its IUPAC name is 3-oxoicosanethioic S-acid.
Molecular Properties
| Compound Name | 3-oxoicosanethioic S-acid |
| PubChem CID | 57319245 |
| Molecular Formula | C20H38O2S |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 3-oxoicosanethioic S-acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)CC(=O)S |
| InChI | InChI=1S/C20H38O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)18-20(22)23/h2-18H2,1H3,(H,22,23) |
| InChIKey | WKCBAQJJMMJBQR-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-oxoicosanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxoicosanethioic S-acid?
The IUPAC name of 3-oxoicosanethioic S-acid (CID 57319245) is 3-oxoicosanethioic S-acid.
What is the SMILES notation for 3-oxoicosanethioic S-acid?
The canonical SMILES for 3-oxoicosanethioic S-acid is CCCCCCCCCCCCCCCCCC(=O)CC(=O)S.
What is the InChIKey of 3-oxoicosanethioic S-acid?
The InChIKey is WKCBAQJJMMJBQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)18-20(22)23/h2-18H2,1H3,(H,22,23).
What are the key properties of 3-oxoicosanethioic S-acid?
3-oxoicosanethioic S-acid has a molecular weight of 342.59 g/mol, XLogP of 6.66, 18 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxoicosanethioic S-acid is sourced from PubChem (CID 57319245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).