About (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine
(3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine (PubChem CID 57319309) has the molecular formula C30H32N2O
and a molecular weight of 436.60 g/mol. Its IUPAC name is (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine.
Molecular Properties
| Compound Name | (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine |
| PubChem CID | 57319309 |
| Molecular Formula | C30H32N2O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine |
| SMILES | CC(C)[C@@H](N)C(OCc1ccccn1)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O/c1-23(2)28(31)29(33-22-27-20-12-13-21-32-27)30(24-14-6-3-7-15-24,25-16-8-4-9-17-25)26-18-10-5-11-19-26/h3-21,23,28-29H,22,31H2,1-2H3/t28-,29?/m1/s1 |
| InChIKey | UJSOIEGBBCGZNN-FICMROCWSA-N |
| XLogP | 5.98 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine?
The IUPAC name of (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine (CID 57319309) is (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine.
What is the SMILES notation for (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine?
The canonical SMILES for (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine is CC(C)[C@@H](N)C(OCc1ccccn1)C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine?
The InChIKey is UJSOIEGBBCGZNN-FICMROCWSA-N. The full InChI is InChI=1S/C30H32N2O/c1-23(2)28(31)29(33-22-27-20-12-13-21-32-27)30(24-14-6-3-7-15-24,25-16-8-4-9-17-25)26-18-10-5-11-19-26/h3-21,23,28-29H,22,31H2,1-2H3/t28-,29?/m1/s1.
What are the key properties of (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine?
(3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine has a molecular weight of 436.60 g/mol, XLogP of 5.98, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-methyl-1,1,1-triphenyl-2-(pyridin-2-ylmethoxy)pentan-3-amine is sourced from PubChem (CID 57319309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).