C27H44O5 — CID 57319519
(3aR,4R,5R,6aR)-6a-methyl-5-(oxan-2-yloxy)-4-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-1,3,3a,4,5,6-hexahydropentalen-2-one (PubChem CID 57319519) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is (3aR,4R,5R,6aR)-6a-methyl-5-(oxan-2-yloxy)-4-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-1,3,3a,4,5,6-hexahydropentalen-2-one.
| Compound Name | (3aR,4R,5R,6aR)-6a-methyl-5-(oxan-2-yloxy)-4-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-1,3,3a,4,5,6-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 57319519 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | (3aR,4R,5R,6aR)-6a-methyl-5-(oxan-2-yloxy)-4-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-1,3,3a,4,5,6-hexahydropentalen-2-one |
| SMILES | CCCCC[C@@H](C=C[C@@H]1[C@H]2CC(=O)C[C@@]2(C)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C27H44O5/c1-3-4-5-10-21(31-25-11-6-8-15-29-25)13-14-22-23-17-20(28)18-27(23,2)19-24(22)32-26-12-7-9-16-30-26/h13-14,21-26H,3-12,15-19H2,1-2H3/t21-,22+,23+,24+,25?,26?,27-/m0/s1 |
| InChIKey | URADYMJCCFVJKP-FCQIOFDFSA-N |
| XLogP | 5.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|