About (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid
(2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57319714) has the molecular formula C18H32NO3S+
and a molecular weight of 342.53 g/mol. Its IUPAC name is (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| PubChem CID | 57319714 |
| Molecular Formula | C18H32NO3S+ |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCCC1(CCC)CCC(C(=O)[N+]2(C(=O)O)CCC[C@H]2C)C1S |
| InChI | InChI=1S/C18H31NO3S/c1-4-9-18(10-5-2)11-8-14(15(18)23)16(20)19(17(21)22)12-6-7-13(19)3/h13-15H,4-12H2,1-3H3,(H-,21,22,23)/p+1/t13-,14?,15?,19?/m1/s1 |
| InChIKey | WDYPGYWRQJQMGY-LSOFMIKDSA-O |
| XLogP | 4.49 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
The IUPAC name of (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (CID 57319714) is (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
What is the SMILES notation for (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
The canonical SMILES for (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid is CCCC1(CCC)CCC(C(=O)[N+]2(C(=O)O)CCC[C@H]2C)C1S.
What is the InChIKey of (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
The InChIKey is WDYPGYWRQJQMGY-LSOFMIKDSA-O. The full InChI is InChI=1S/C18H31NO3S/c1-4-9-18(10-5-2)11-8-14(15(18)23)16(20)19(17(21)22)12-6-7-13(19)3/h13-15H,4-12H2,1-3H3,(H-,21,22,23)/p+1/t13-,14?,15?,19?/m1/s1.
What are the key properties of (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid?
(2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid has a molecular weight of 342.53 g/mol, XLogP of 4.49, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(3,3-dipropyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid is sourced from PubChem (CID 57319714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).