C19H18F6 — CID 57319758
4-[1-(3,4-dimethylphenyl)-1,2,2,3,3,3-hexafluoropropyl]-1,2-dimethylbenzene (PubChem CID 57319758) has the molecular formula C19H18F6 and a molecular weight of 360.34 g/mol. Its IUPAC name is 4-[1-(3,4-dimethylphenyl)-1,2,2,3,3,3-hexafluoropropyl]-1,2-dimethylbenzene.
| Compound Name | 4-[1-(3,4-dimethylphenyl)-1,2,2,3,3,3-hexafluoropropyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 57319758 |
| Molecular Formula | C19H18F6 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-[1-(3,4-dimethylphenyl)-1,2,2,3,3,3-hexafluoropropyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(F)(c2ccc(C)c(C)c2)C(F)(F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C19H18F6/c1-11-5-7-15(9-13(11)3)17(20,18(21,22)19(23,24)25)16-8-6-12(2)14(4)10-16/h5-10H,1-4H3 |
| InChIKey | RBKBUFYMRZZSNI-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|