About 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane
4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane (PubChem CID 57319846) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane |
| PubChem CID | 57319846 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane |
| SMILES | CC1CN2C3CCC(C3)C2(C)C1 |
| InChI | InChI=1S/C11H19N/c1-8-6-11(2)9-3-4-10(5-9)12(11)7-8/h8-10H,3-7H2,1-2H3 |
| InChIKey | OSILJDPPVBVKGN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane?
The IUPAC name of 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane (CID 57319846) is 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane?
The canonical SMILES for 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane is CC1CN2C3CCC(C3)C2(C)C1.
What is the InChIKey of 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane?
The InChIKey is OSILJDPPVBVKGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-8-6-11(2)9-3-4-10(5-9)12(11)7-8/h8-10H,3-7H2,1-2H3.
What are the key properties of 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane?
4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane has a molecular weight of 165.28 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2-azatricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 57319846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).