About propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate
propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate (PubChem CID 57320081) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate.
Molecular Properties
| Compound Name | propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate |
| PubChem CID | 57320081 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate |
| SMILES | CCCOC(=O)C[C@H]1CC[C@H](C)[C@H]1COC(C)=O |
| InChI | InChI=1S/C14H24O4/c1-4-7-17-14(16)8-12-6-5-10(2)13(12)9-18-11(3)15/h10,12-13H,4-9H2,1-3H3/t10-,12+,13+/m0/s1 |
| InChIKey | YWHKZILIERQFOV-CYZMBNFOSA-N |
| XLogP | 2.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate?
The IUPAC name of propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate (CID 57320081) is propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate.
What is the SMILES notation for propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate?
The canonical SMILES for propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate is CCCOC(=O)C[C@H]1CC[C@H](C)[C@H]1COC(C)=O.
What is the InChIKey of propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate?
The InChIKey is YWHKZILIERQFOV-CYZMBNFOSA-N. The full InChI is InChI=1S/C14H24O4/c1-4-7-17-14(16)8-12-6-5-10(2)13(12)9-18-11(3)15/h10,12-13H,4-9H2,1-3H3/t10-,12+,13+/m0/s1.
What are the key properties of propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate?
propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate has a molecular weight of 256.34 g/mol, XLogP of 2.56, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-[(1R,2R,3S)-2-(acetyloxymethyl)-3-methylcyclopentyl]acetate is sourced from PubChem (CID 57320081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).