C20H15Cl5N2 — CID 57320114
1-[(2-chlorophenyl)-(5,6,7,8-tetrachloro-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]imidazole (PubChem CID 57320114) has the molecular formula C20H15Cl5N2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)-(5,6,7,8-tetrachloro-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]imidazole.
| Compound Name | 1-[(2-chlorophenyl)-(5,6,7,8-tetrachloro-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]imidazole |
|---|---|
| PubChem CID | 57320114 |
| Molecular Formula | C20H15Cl5N2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 1-[(2-chlorophenyl)-(5,6,7,8-tetrachloro-5,6,7,8-tetrahydronaphthalen-2-yl)methyl]imidazole |
| SMILES | Clc1ccccc1C(c1ccc2c(c1)C(Cl)C(Cl)C(Cl)C2Cl)n1ccnc1 |
| InChI | InChI=1S/C20H15Cl5N2/c21-15-4-2-1-3-13(15)20(27-8-7-26-10-27)11-5-6-12-14(9-11)17(23)19(25)18(24)16(12)22/h1-10,16-20H |
| InChIKey | WTSSFLJHJRTWTF-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|