C12H15N2O3S2+ — CID 57320138
(3-amino-1,3-thiazol-3-ium-2-yl) 2,4,6-trimethylbenzenesulfonate (PubChem CID 57320138) has the molecular formula C12H15N2O3S2+ and a molecular weight of 299.40 g/mol. Its IUPAC name is (3-amino-1,3-thiazol-3-ium-2-yl) 2,4,6-trimethylbenzenesulfonate.
| Compound Name | (3-amino-1,3-thiazol-3-ium-2-yl) 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 57320138 |
| Molecular Formula | C12H15N2O3S2+ |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (3-amino-1,3-thiazol-3-ium-2-yl) 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2scc[n+]2N)c(C)c1 |
| InChI | InChI=1S/C12H15N2O3S2/c1-8-6-9(2)11(10(3)7-8)19(15,16)17-12-14(13)4-5-18-12/h4-7H,13H2,1-3H3/q+1 |
| InChIKey | VCJAJSXQVHMRAQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|