C24H38N2O2 — CID 57320238
(8S,9R,10R,13S,14S)-N-tert-butyl-4-imino-10,13-dimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxamide (PubChem CID 57320238) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-N-tert-butyl-4-imino-10,13-dimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxamide.
| Compound Name | (8S,9R,10R,13S,14S)-N-tert-butyl-4-imino-10,13-dimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxamide |
|---|---|
| PubChem CID | 57320238 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (8S,9R,10R,13S,14S)-N-tert-butyl-4-imino-10,13-dimethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carboxamide |
| SMILES | [H]/N=C1\C(=O)C(C(=O)NC(C)(C)C)C[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C24H38N2O2/c1-22(2,3)26-21(28)15-13-24(5)17-10-12-23(4)11-6-7-16(23)14(17)8-9-18(24)19(25)20(15)27/h14-18,25H,6-13H2,1-5H3,(H,26,28)/b25-19-/t14-,15?,16-,17+,18?,23-,24+/m0/s1 |
| InChIKey | UXVWPFITXOCBHP-RHEYBVKTSA-N |
| XLogP | 4.76 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|