C20H27ClN5O9P — CID 57320264
[3-[2-(6-chloro-2,5-diformamidopyrimidin-4-yl)pyrrol-2-yl]oxy-2-(diethoxyphosphorylmethoxy)propyl] acetate (PubChem CID 57320264) has the molecular formula C20H27ClN5O9P and a molecular weight of 547.89 g/mol. Its IUPAC name is [3-[2-(6-chloro-2,5-diformamidopyrimidin-4-yl)pyrrol-2-yl]oxy-2-(diethoxyphosphorylmethoxy)propyl] acetate.
| Compound Name | [3-[2-(6-chloro-2,5-diformamidopyrimidin-4-yl)pyrrol-2-yl]oxy-2-(diethoxyphosphorylmethoxy)propyl] acetate |
|---|---|
| PubChem CID | 57320264 |
| Molecular Formula | C20H27ClN5O9P |
| Molecular Weight | 547.89 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | [3-[2-(6-chloro-2,5-diformamidopyrimidin-4-yl)pyrrol-2-yl]oxy-2-(diethoxyphosphorylmethoxy)propyl] acetate |
| SMILES | CCOP(=O)(COC(COC(C)=O)COC1(c2nc(NC=O)nc(Cl)c2NC=O)C=CC=N1)OCC |
| InChI | InChI=1S/C20H27ClN5O9P/c1-4-34-36(30,35-5-2)13-32-15(9-31-14(3)29)10-33-20(7-6-8-24-20)17-16(22-11-27)18(21)26-19(25-17)23-12-28/h6-8,11-12,15H,4-5,9-10,13H2,1-3H3,(H,22,27)(H,23,25,26,28) |
| InChIKey | NVTLXPPPAJQOTR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 176.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.89 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|