C24H42N2O5 — CID 57320416
ditert-butyl (2S,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 57320416) has the molecular formula C24H42N2O5 and a molecular weight of 438.61 g/mol. Its IUPAC name is ditert-butyl (2S,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57320416 |
| Molecular Formula | C24H42N2O5 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | ditert-butyl (2S,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC=C[C@@H]1C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C24H42N2O5/c1-11-12-17-14-19(21(28)30-23(5,6)7)26(22(29)31-24(8,9)10)20(17)18(13-15(2)3)25-16(4)27/h11-12,15,17-20H,13-14H2,1-10H3,(H,25,27)/t17-,18+,19+,20-/m1/s1 |
| InChIKey | SXKZPVMDXSQSKD-FUMNGEBKSA-N |
| XLogP | 4.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|