C22H32O3 — CID 57320450
(5S,8S,10S,13S,14S,16R,17S)-17-acetyl-1-hydroxy-10,13,16-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57320450) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (5S,8S,10S,13S,14S,16R,17S)-17-acetyl-1-hydroxy-10,13,16-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,8S,10S,13S,14S,16R,17S)-17-acetyl-1-hydroxy-10,13,16-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57320450 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (5S,8S,10S,13S,14S,16R,17S)-17-acetyl-1-hydroxy-10,13,16-trimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1[C@H](C)C[C@H]2[C@@H]3CC[C@H]4CC(=O)CC(O)[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C22H32O3/c1-12-9-18-16-6-5-14-10-15(24)11-19(25)22(14,4)17(16)7-8-21(18,3)20(12)13(2)23/h7,12,14,16,18-20,25H,5-6,8-11H2,1-4H3/t12-,14+,16-,18+,19?,20-,21+,22+/m1/s1 |
| InChIKey | WCWDHMZYLJLTLU-ZYRBIRHDSA-N |
| XLogP | 3.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|