C9H16F5NO2S — CID 57320744
3-(4,4,5,5,5-pentafluoropentylsulfonyl)butan-1-amine (PubChem CID 57320744) has the molecular formula C9H16F5NO2S and a molecular weight of 297.29 g/mol. Its IUPAC name is 3-(4,4,5,5,5-pentafluoropentylsulfonyl)butan-1-amine.
| Compound Name | 3-(4,4,5,5,5-pentafluoropentylsulfonyl)butan-1-amine |
|---|---|
| PubChem CID | 57320744 |
| Molecular Formula | C9H16F5NO2S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-(4,4,5,5,5-pentafluoropentylsulfonyl)butan-1-amine |
| SMILES | CC(CCN)S(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H16F5NO2S/c1-7(3-5-15)18(16,17)6-2-4-8(10,11)9(12,13)14/h7H,2-6,15H2,1H3 |
| InChIKey | ROIOFOXKUBQWCD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|