About prop-1-enyl hydrogen sulfite
prop-1-enyl hydrogen sulfite (PubChem CID 57320811) has the molecular formula C3H6O3S
and a molecular weight of 122.14 g/mol. Its IUPAC name is prop-1-enyl hydrogen sulfite.
Molecular Properties
| Compound Name | prop-1-enyl hydrogen sulfite |
| PubChem CID | 57320811 |
| Molecular Formula | C3H6O3S |
| Molecular Weight | 122.14 g/mol |
| Exact Mass | 122.00 |
| IUPAC Name | prop-1-enyl hydrogen sulfite |
| SMILES | CC=COS(=O)O |
| InChI | InChI=1S/C3H6O3S/c1-2-3-6-7(4)5/h2-3H,1H3,(H,4,5) |
| InChIKey | UVFQGNOZULDQMA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze prop-1-enyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-enyl hydrogen sulfite?
The IUPAC name of prop-1-enyl hydrogen sulfite (CID 57320811) is prop-1-enyl hydrogen sulfite.
What is the SMILES notation for prop-1-enyl hydrogen sulfite?
The canonical SMILES for prop-1-enyl hydrogen sulfite is CC=COS(=O)O.
What is the InChIKey of prop-1-enyl hydrogen sulfite?
The InChIKey is UVFQGNOZULDQMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3S/c1-2-3-6-7(4)5/h2-3H,1H3,(H,4,5).
What are the key properties of prop-1-enyl hydrogen sulfite?
prop-1-enyl hydrogen sulfite has a molecular weight of 122.14 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-enyl hydrogen sulfite is sourced from PubChem (CID 57320811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).