C39H51N5O5 — CID 57320886
[1-[[1-(6-aminohexylamino)-1-oxo-3-phenylpropan-2-yl]-methylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamoyl 2-imino-5-methylhexanoate (PubChem CID 57320886) has the molecular formula C39H51N5O5 and a molecular weight of 669.87 g/mol. Its IUPAC name is [1-[[1-(6-aminohexylamino)-1-oxo-3-phenylpropan-2-yl]-methylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamoyl 2-imino-5-methylhexanoate.
| Compound Name | [1-[[1-(6-aminohexylamino)-1-oxo-3-phenylpropan-2-yl]-methylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamoyl 2-imino-5-methylhexanoate |
|---|---|
| PubChem CID | 57320886 |
| Molecular Formula | C39H51N5O5 |
| Molecular Weight | 669.87 g/mol |
| Exact Mass | 669.39 |
| IUPAC Name | [1-[[1-(6-aminohexylamino)-1-oxo-3-phenylpropan-2-yl]-methylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamoyl 2-imino-5-methylhexanoate |
| SMILES | [H]/N=C(\CCC(C)C)C(=O)OC(=O)NC(Cc1ccc(-c2ccccc2)cc1)C(=O)N(C)C(Cc1ccccc1)C(=O)NCCCCCCN |
| InChI | InChI=1S/C39H51N5O5/c1-28(2)18-23-33(41)38(47)49-39(48)43-34(26-30-19-21-32(22-20-30)31-16-10-7-11-17-31)37(46)44(3)35(27-29-14-8-6-9-15-29)36(45)42-25-13-5-4-12-24-40/h6-11,14-17,19-22,28,34-35,41H,4-5,12-13,18,23-27,40H2,1-3H3,(H,42,45)(H,43,48)/b41-33+ |
| InChIKey | QHFDHTXWPORFBC-ZSJGZSGZSA-N |
| XLogP | 5.68 |
| TPSA | 154.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.87 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|