About propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate
propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate (PubChem CID 57321121) has the molecular formula C17H17N3O3
and a molecular weight of 311.34 g/mol. Its IUPAC name is propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate |
| PubChem CID | 57321121 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate |
| SMILES | CC(C)OC(=O)N1c2ncccc2NC(=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17N3O3/c1-11(2)23-17(22)20-14(12-7-4-3-5-8-12)16(21)19-13-9-6-10-18-15(13)20/h3-11,14H,1-2H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | UXYGGBNOJOHSTD-CQSZACIVSA-N |
| XLogP | 3.13 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate?
The IUPAC name of propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate (CID 57321121) is propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate.
What is the SMILES notation for propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate?
The canonical SMILES for propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate is CC(C)OC(=O)N1c2ncccc2NC(=O)[C@H]1c1ccccc1.
What is the InChIKey of propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate?
The InChIKey is UXYGGBNOJOHSTD-CQSZACIVSA-N. The full InChI is InChI=1S/C17H17N3O3/c1-11(2)23-17(22)20-14(12-7-4-3-5-8-12)16(21)19-13-9-6-10-18-15(13)20/h3-11,14H,1-2H3,(H,19,21)/t14-/m1/s1.
What are the key properties of propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate?
propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate has a molecular weight of 311.34 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (3R)-2-oxo-3-phenyl-1,3-dihydropyrido[2,3-b]pyrazine-4-carboxylate is sourced from PubChem (CID 57321121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).