About 2-iminobutanamide
2-iminobutanamide (PubChem CID 57321581) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is 2-iminobutanamide.
Molecular Properties
| Compound Name | 2-iminobutanamide |
| PubChem CID | 57321581 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | 2-iminobutanamide |
| SMILES | [H]/N=C(\CC)C(N)=O |
| InChI | InChI=1S/C4H8N2O/c1-2-3(5)4(6)7/h5H,2H2,1H3,(H2,6,7)/b5-3+ |
| InChIKey | VHYSSNZDRQLCCM-HWKANZROSA-N |
| XLogP | -0.10 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminobutanamide?
The IUPAC name of 2-iminobutanamide (CID 57321581) is 2-iminobutanamide.
What is the SMILES notation for 2-iminobutanamide?
The canonical SMILES for 2-iminobutanamide is [H]/N=C(\CC)C(N)=O.
What is the InChIKey of 2-iminobutanamide?
The InChIKey is VHYSSNZDRQLCCM-HWKANZROSA-N. The full InChI is InChI=1S/C4H8N2O/c1-2-3(5)4(6)7/h5H,2H2,1H3,(H2,6,7)/b5-3+.
What are the key properties of 2-iminobutanamide?
2-iminobutanamide has a molecular weight of 100.12 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminobutanamide is sourced from PubChem (CID 57321581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).