C21H22FN3O3 — CID 57321759
1-[2-(2,2-dimethoxyethylamino)-5-(2-fluorophenyl)-1H-1,4-benzodiazepin-7-yl]ethanone (PubChem CID 57321759) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 1-[2-(2,2-dimethoxyethylamino)-5-(2-fluorophenyl)-1H-1,4-benzodiazepin-7-yl]ethanone.
| Compound Name | 1-[2-(2,2-dimethoxyethylamino)-5-(2-fluorophenyl)-1H-1,4-benzodiazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 57321759 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-[2-(2,2-dimethoxyethylamino)-5-(2-fluorophenyl)-1H-1,4-benzodiazepin-7-yl]ethanone |
| SMILES | COC(CNC1=CN=C(c2ccccc2F)c2cc(C(C)=O)ccc2N1)OC |
| InChI | InChI=1S/C21H22FN3O3/c1-13(26)14-8-9-18-16(10-14)21(15-6-4-5-7-17(15)22)24-11-19(25-18)23-12-20(27-2)28-3/h4-11,20,23,25H,12H2,1-3H3 |
| InChIKey | QGDDBWCDTPRFDL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|