About 2,5-dimethyl-3,4-dihydro-2H-thiopyran
2,5-dimethyl-3,4-dihydro-2H-thiopyran (PubChem CID 57321965) has the molecular formula C7H12S
and a molecular weight of 128.24 g/mol. Its IUPAC name is 2,5-dimethyl-3,4-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 2,5-dimethyl-3,4-dihydro-2H-thiopyran |
| PubChem CID | 57321965 |
| Molecular Formula | C7H12S |
| Molecular Weight | 128.24 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 2,5-dimethyl-3,4-dihydro-2H-thiopyran |
| SMILES | CC1=CSC(C)CC1 |
| InChI | InChI=1S/C7H12S/c1-6-3-4-7(2)8-5-6/h5,7H,3-4H2,1-2H3 |
| InChIKey | VXVWRZPIZZMQKH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethyl-3,4-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3,4-dihydro-2H-thiopyran?
The IUPAC name of 2,5-dimethyl-3,4-dihydro-2H-thiopyran (CID 57321965) is 2,5-dimethyl-3,4-dihydro-2H-thiopyran.
What is the SMILES notation for 2,5-dimethyl-3,4-dihydro-2H-thiopyran?
The canonical SMILES for 2,5-dimethyl-3,4-dihydro-2H-thiopyran is CC1=CSC(C)CC1.
What is the InChIKey of 2,5-dimethyl-3,4-dihydro-2H-thiopyran?
The InChIKey is VXVWRZPIZZMQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12S/c1-6-3-4-7(2)8-5-6/h5,7H,3-4H2,1-2H3.
What are the key properties of 2,5-dimethyl-3,4-dihydro-2H-thiopyran?
2,5-dimethyl-3,4-dihydro-2H-thiopyran has a molecular weight of 128.24 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3,4-dihydro-2H-thiopyran is sourced from PubChem (CID 57321965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).