C13H20O — CID 57322545
5-butyl-5,6,7,8-tetrahydro-1H-isochromene (PubChem CID 57322545) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 5-butyl-5,6,7,8-tetrahydro-1H-isochromene.
| Compound Name | 5-butyl-5,6,7,8-tetrahydro-1H-isochromene |
|---|---|
| PubChem CID | 57322545 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 5-butyl-5,6,7,8-tetrahydro-1H-isochromene |
| SMILES | CCCCC1CCCC2=C1C=COC2 |
| InChI | InChI=1S/C13H20O/c1-2-3-5-11-6-4-7-12-10-14-9-8-13(11)12/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | XOURFYIGHRTJON-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |