About 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol
5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol (PubChem CID 57322550) has the molecular formula C8H8O6
and a molecular weight of 200.15 g/mol. Its IUPAC name is 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol.
Molecular Properties
| Compound Name | 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol |
| PubChem CID | 57322550 |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol |
| SMILES | OC(O)=c1c(O)ccc(O)c1=C(O)O |
| InChI | InChI=1S/C8H8O6/c9-3-1-2-4(10)6(8(13)14)5(3)7(11)12/h1-2,9-14H |
| InChIKey | FYMLKUHIKRBPLF-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol?
The IUPAC name of 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol (CID 57322550) is 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol.
What is the SMILES notation for 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol?
The canonical SMILES for 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol is OC(O)=c1c(O)ccc(O)c1=C(O)O.
What is the InChIKey of 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol?
The InChIKey is FYMLKUHIKRBPLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O6/c9-3-1-2-4(10)6(8(13)14)5(3)7(11)12/h1-2,9-14H.
What are the key properties of 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol?
5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol has a molecular weight of 200.15 g/mol, XLogP of -0.54, 0 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(dihydroxymethylidene)cyclohexa-1,3-diene-1,4-diol is sourced from PubChem (CID 57322550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).