C20H30O2 — CID 573227
1,2-bis(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethane-1,2-diol (PubChem CID 573227) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1,2-bis(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethane-1,2-diol.
| Compound Name | 1,2-bis(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 573227 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1,2-bis(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethane-1,2-diol |
| SMILES | CC1(C)C2CC=C(C(O)C(O)C3=CCC4CC3C4(C)C)C1C2 |
| InChI | InChI=1S/C20H30O2/c1-19(2)11-5-7-13(15(19)9-11)17(21)18(22)14-8-6-12-10-16(14)20(12,3)4/h7-8,11-12,15-18,21-22H,5-6,9-10H2,1-4H3 |
| InChIKey | JOXINIOTZNSSOY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|