C9H11NO3 — CID 57322728
2-methyl-6-nitro-2,3,4,5-tetrahydro-1-benzofuran (PubChem CID 57322728) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-methyl-6-nitro-2,3,4,5-tetrahydro-1-benzofuran.
| Compound Name | 2-methyl-6-nitro-2,3,4,5-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 57322728 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-methyl-6-nitro-2,3,4,5-tetrahydro-1-benzofuran |
| SMILES | CC1CC2=C(C=C([N+](=O)[O-])CC2)O1 |
| InChI | InChI=1S/C9H11NO3/c1-6-4-7-2-3-8(10(11)12)5-9(7)13-6/h5-6H,2-4H2,1H3 |
| InChIKey | HMOFJIZLHXHPJQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|