About 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol
3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol (PubChem CID 57322813) has the molecular formula C14H26OS
and a molecular weight of 242.43 g/mol. Its IUPAC name is 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol.
Molecular Properties
| Compound Name | 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol |
| PubChem CID | 57322813 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol |
| SMILES | CSC(C)CC(O)C1=C(C)C(C)(C)CCC1 |
| InChI | InChI=1S/C14H26OS/c1-10(16-5)9-13(15)12-7-6-8-14(3,4)11(12)2/h10,13,15H,6-9H2,1-5H3 |
| InChIKey | BQNCLVGEGQQESA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol?
The IUPAC name of 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol (CID 57322813) is 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol.
What is the SMILES notation for 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol?
The canonical SMILES for 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol is CSC(C)CC(O)C1=C(C)C(C)(C)CCC1.
What is the InChIKey of 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol?
The InChIKey is BQNCLVGEGQQESA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26OS/c1-10(16-5)9-13(15)12-7-6-8-14(3,4)11(12)2/h10,13,15H,6-9H2,1-5H3.
What are the key properties of 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol?
3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol has a molecular weight of 242.43 g/mol, XLogP of 4.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanyl-1-(2,3,3-trimethylcyclohexen-1-yl)butan-1-ol is sourced from PubChem (CID 57322813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).