About ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate
ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 57322866) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 57322866 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1COC(C(C)N)=N1 |
| InChI | InChI=1S/C8H14N2O3/c1-3-12-8(11)6-4-13-7(10-6)5(2)9/h5-6H,3-4,9H2,1-2H3/t5?,6-/m0/s1 |
| InChIKey | HPIUHGXBWUMWLH-GDVGLLTNSA-N |
| XLogP | -0.31 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 57322866) is ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is CCOC(=O)[C@@H]1COC(C(C)N)=N1.
What is the InChIKey of ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is HPIUHGXBWUMWLH-GDVGLLTNSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-3-12-8(11)6-4-13-7(10-6)5(2)9/h5-6H,3-4,9H2,1-2H3/t5?,6-/m0/s1.
What are the key properties of ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 186.21 g/mol, XLogP of -0.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4S)-2-(1-aminoethyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 57322866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).