About 3-benzylidenepyrazole
3-benzylidenepyrazole (PubChem CID 57322880) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 3-benzylidenepyrazole.
Molecular Properties
| Compound Name | 3-benzylidenepyrazole |
| PubChem CID | 57322880 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 3-benzylidenepyrazole |
| SMILES | C1=CC(=Cc2ccccc2)N=N1 |
| InChI | InChI=1S/C10H8N2/c1-2-4-9(5-3-1)8-10-6-7-11-12-10/h1-8H |
| InChIKey | CBXNRSSTCRWYNP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzylidenepyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylidenepyrazole?
The IUPAC name of 3-benzylidenepyrazole (CID 57322880) is 3-benzylidenepyrazole.
What is the SMILES notation for 3-benzylidenepyrazole?
The canonical SMILES for 3-benzylidenepyrazole is C1=CC(=Cc2ccccc2)N=N1.
What is the InChIKey of 3-benzylidenepyrazole?
The InChIKey is CBXNRSSTCRWYNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-4-9(5-3-1)8-10-6-7-11-12-10/h1-8H.
What are the key properties of 3-benzylidenepyrazole?
3-benzylidenepyrazole has a molecular weight of 156.19 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylidenepyrazole is sourced from PubChem (CID 57322880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).