C15H30O4S — CID 57323128
(2S,3S,4R,5R,6R)-2-(hydroxymethyl)-6-nonan-5-ylthiane-3,4,5-triol (PubChem CID 57323128) has the molecular formula C15H30O4S and a molecular weight of 306.47 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-(hydroxymethyl)-6-nonan-5-ylthiane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6R)-2-(hydroxymethyl)-6-nonan-5-ylthiane-3,4,5-triol |
|---|---|
| PubChem CID | 57323128 |
| Molecular Formula | C15H30O4S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-(hydroxymethyl)-6-nonan-5-ylthiane-3,4,5-triol |
| SMILES | CCCCC(CCCC)[C@H]1S[C@@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H30O4S/c1-3-5-7-10(8-6-4-2)15-14(19)13(18)12(17)11(9-16)20-15/h10-19H,3-9H2,1-2H3/t11-,12+,13-,14+,15+/m0/s1 |
| InChIKey | GIAAETDGRHSMBY-XPABHHOTSA-N |
| XLogP | 1.54 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |