C6H10N2O — CID 57323252
1-(1,2,3,6-tetrahydropyrazin-3-yl)ethanone (PubChem CID 57323252) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-(1,2,3,6-tetrahydropyrazin-3-yl)ethanone.
| Compound Name | 1-(1,2,3,6-tetrahydropyrazin-3-yl)ethanone |
|---|---|
| PubChem CID | 57323252 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 1-(1,2,3,6-tetrahydropyrazin-3-yl)ethanone |
| SMILES | CC(=O)C1CNCC=N1 |
| InChI | InChI=1S/C6H10N2O/c1-5(9)6-4-7-2-3-8-6/h3,6-7H,2,4H2,1H3 |
| InChIKey | VKWOBZAZEOZDDQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |