About (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene
(2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene (PubChem CID 57323345) has the molecular formula C21H20N4O2
and a molecular weight of 360.42 g/mol. Its IUPAC name is (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene.
Molecular Properties
| Compound Name | (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene |
| PubChem CID | 57323345 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene |
| SMILES | CCC1(C)Cc2ccc(/N=N/c3ccc([N+](=O)[O-])cc3)c3cccc(c23)N1 |
| InChI | InChI=1S/C21H20N4O2/c1-3-21(2)13-14-7-12-18(17-5-4-6-19(22-21)20(14)17)24-23-15-8-10-16(11-9-15)25(26)27/h4-12,22H,3,13H2,1-2H3/b24-23+ |
| InChIKey | RQMRALPRGSPGLZ-WCWDXBQESA-N |
| XLogP | 6.30 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene?
The IUPAC name of (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene (CID 57323345) is (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene.
What is the SMILES notation for (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene?
The canonical SMILES for (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene is CCC1(C)Cc2ccc(/N=N/c3ccc([N+](=O)[O-])cc3)c3cccc(c23)N1.
What is the InChIKey of (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene?
The InChIKey is RQMRALPRGSPGLZ-WCWDXBQESA-N. The full InChI is InChI=1S/C21H20N4O2/c1-3-21(2)13-14-7-12-18(17-5-4-6-19(22-21)20(14)17)24-23-15-8-10-16(11-9-15)25(26)27/h4-12,22H,3,13H2,1-2H3/b24-23+.
What are the key properties of (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene?
(2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene has a molecular weight of 360.42 g/mol, XLogP of 6.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-2-methyl-1,3-dihydrobenzo[de]quinolin-6-yl)-(4-nitrophenyl)diazene is sourced from PubChem (CID 57323345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).