C23H35NO2S — CID 57323399
(4aR,5R,6R,7R)-7-ethylsulfanyl-1,3,4a,5-tetramethyl-6-(3-methylbutoxy)-4,5,6,7-tetrahydrobenzo[f]indol-2-one (PubChem CID 57323399) has the molecular formula C23H35NO2S and a molecular weight of 389.61 g/mol. Its IUPAC name is (4aR,5R,6R,7R)-7-ethylsulfanyl-1,3,4a,5-tetramethyl-6-(3-methylbutoxy)-4,5,6,7-tetrahydrobenzo[f]indol-2-one.
| Compound Name | (4aR,5R,6R,7R)-7-ethylsulfanyl-1,3,4a,5-tetramethyl-6-(3-methylbutoxy)-4,5,6,7-tetrahydrobenzo[f]indol-2-one |
|---|---|
| PubChem CID | 57323399 |
| Molecular Formula | C23H35NO2S |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (4aR,5R,6R,7R)-7-ethylsulfanyl-1,3,4a,5-tetramethyl-6-(3-methylbutoxy)-4,5,6,7-tetrahydrobenzo[f]indol-2-one |
| SMILES | CCS[C@@H]1C=C2C=C3C(=C(C)C(=O)N3C)C[C@]2(C)[C@@H](C)[C@H]1OCCC(C)C |
| InChI | InChI=1S/C23H35NO2S/c1-8-27-20-12-17-11-19-18(15(4)22(25)24(19)7)13-23(17,6)16(5)21(20)26-10-9-14(2)3/h11-12,14,16,20-21H,8-10,13H2,1-7H3/t16-,20+,21+,23+/m0/s1 |
| InChIKey | ARCZZSDGOJUPNG-JNHGLSHCSA-N |
| XLogP | 5.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |