C17H27FO4 — CID 57324769
(3S,3aR,4R,5R,6aS)-3-fluoro-5-hydroxy-4-(3-hydroxy-4,4-dimethyloct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 57324769) has the molecular formula C17H27FO4 and a molecular weight of 314.40 g/mol. Its IUPAC name is (3S,3aR,4R,5R,6aS)-3-fluoro-5-hydroxy-4-(3-hydroxy-4,4-dimethyloct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3S,3aR,4R,5R,6aS)-3-fluoro-5-hydroxy-4-(3-hydroxy-4,4-dimethyloct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 57324769 |
| Molecular Formula | C17H27FO4 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (3S,3aR,4R,5R,6aS)-3-fluoro-5-hydroxy-4-(3-hydroxy-4,4-dimethyloct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(C)C(O)C=C[C@@H]1[C@@H]2[C@H](C[C@H]1O)OC(=O)[C@H]2F |
| InChI | InChI=1S/C17H27FO4/c1-4-5-8-17(2,3)13(20)7-6-10-11(19)9-12-14(10)15(18)16(21)22-12/h6-7,10-15,19-20H,4-5,8-9H2,1-3H3/t10-,11+,12-,13?,14+,15-/m0/s1 |
| InChIKey | GZZAEVSOJGTDBN-JCEPKTAQSA-N |
| XLogP | 2.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|