About 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole
2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole (PubChem CID 573249) has the molecular formula C10H9FN2S2
and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole |
| PubChem CID | 573249 |
| Molecular Formula | C10H9FN2S2 |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(SCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C10H9FN2S2/c1-7-12-13-10(15-7)14-6-8-2-4-9(11)5-3-8/h2-5H,6H2,1H3 |
| InChIKey | MJJRSYAKOCJHOE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole?
The IUPAC name of 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole (CID 573249) is 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole.
What is the SMILES notation for 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole?
The canonical SMILES for 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole is Cc1nnc(SCc2ccc(F)cc2)s1.
What is the InChIKey of 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole?
The InChIKey is MJJRSYAKOCJHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2S2/c1-7-12-13-10(15-7)14-6-8-2-4-9(11)5-3-8/h2-5H,6H2,1H3.
What are the key properties of 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole?
2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole has a molecular weight of 240.33 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorophenyl)methylsulfanyl]-5-methyl-1,3,4-thiadiazole is sourced from PubChem (CID 573249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).