C29H44O4 — CID 57324945
4-hydroxy-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,9-dione (PubChem CID 57324945) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is 4-hydroxy-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,9-dione.
| Compound Name | 4-hydroxy-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,9-dione |
|---|---|
| PubChem CID | 57324945 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 4-hydroxy-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]nonane-2,9-dione |
| SMILES | CC(C)=CCC1CC2(CC=C(C)C)C(=O)C(C(=O)C(C)C)(C(=O)C(CC=C(C)C)C2O)C1C |
| InChI | InChI=1S/C29H44O4/c1-17(2)10-12-22-16-28(15-14-19(5)6)25(31)23(13-11-18(3)4)26(32)29(21(22)9,27(28)33)24(30)20(7)8/h10-11,14,20-23,25,31H,12-13,15-16H2,1-9H3 |
| InChIKey | KUGSZOIQWIBXCH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|