About 1,5-dihydropyrrolo[2,3-c]azepine
1,5-dihydropyrrolo[2,3-c]azepine (PubChem CID 57325040) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 1,5-dihydropyrrolo[2,3-c]azepine.
Molecular Properties
| Compound Name | 1,5-dihydropyrrolo[2,3-c]azepine |
| PubChem CID | 57325040 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 1,5-dihydropyrrolo[2,3-c]azepine |
| SMILES | C1=NC=c2[nH]ccc2=CC1 |
| InChI | InChI=1S/C8H8N2/c1-2-7-3-5-10-8(7)6-9-4-1/h2-6,10H,1H2 |
| InChIKey | KMGOQNSNYBHUPF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-dihydropyrrolo[2,3-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydropyrrolo[2,3-c]azepine?
The IUPAC name of 1,5-dihydropyrrolo[2,3-c]azepine (CID 57325040) is 1,5-dihydropyrrolo[2,3-c]azepine.
What is the SMILES notation for 1,5-dihydropyrrolo[2,3-c]azepine?
The canonical SMILES for 1,5-dihydropyrrolo[2,3-c]azepine is C1=NC=c2[nH]ccc2=CC1.
What is the InChIKey of 1,5-dihydropyrrolo[2,3-c]azepine?
The InChIKey is KMGOQNSNYBHUPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-2-7-3-5-10-8(7)6-9-4-1/h2-6,10H,1H2.
What are the key properties of 1,5-dihydropyrrolo[2,3-c]azepine?
1,5-dihydropyrrolo[2,3-c]azepine has a molecular weight of 132.17 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydropyrrolo[2,3-c]azepine is sourced from PubChem (CID 57325040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).