C25H39NO2Si — CID 57325062
4a-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(cyclopropylmethyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one (PubChem CID 57325062) has the molecular formula C25H39NO2Si and a molecular weight of 413.68 g/mol. Its IUPAC name is 4a-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(cyclopropylmethyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one.
| Compound Name | 4a-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(cyclopropylmethyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 57325062 |
| Molecular Formula | C25H39NO2Si |
| Molecular Weight | 413.68 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 4a-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-(cyclopropylmethyl)-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(C23CCN(CC4CC4)CC2CCC(=O)C3)c1 |
| InChI | InChI=1S/C25H39NO2Si/c1-24(2,3)29(4,5)28-23-8-6-7-20(15-23)25-13-14-26(17-19-9-10-19)18-21(25)11-12-22(27)16-25/h6-8,15,19,21H,9-14,16-18H2,1-5H3 |
| InChIKey | ZIFUTAHHNNNCAO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|