C15H20F11N3O — CID 57325074
N,N-bis(3-aminobutyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide (PubChem CID 57325074) has the molecular formula C15H20F11N3O and a molecular weight of 467.32 g/mol. Its IUPAC name is N,N-bis(3-aminobutyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide.
| Compound Name | N,N-bis(3-aminobutyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 57325074 |
| Molecular Formula | C15H20F11N3O |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N,N-bis(3-aminobutyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
| SMILES | CC(N)CCN(CCC(C)N)C(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H20F11N3O/c1-7(27)3-5-29(6-4-8(2)28)9(30)10(16)11(17,18)13(21,22)15(25,26)14(23,24)12(10,19)20/h7-8H,3-6,27-28H2,1-2H3 |
| InChIKey | SHZKDLKXTIZPIG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|