C23H32O4S — CID 57325303
methyl (8S,9R,10R,13S,14S)-10,13-dimethyl-3-oxo-6-(2-sulfanylacetyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxylate (PubChem CID 57325303) has the molecular formula C23H32O4S and a molecular weight of 404.57 g/mol. Its IUPAC name is methyl (8S,9R,10R,13S,14S)-10,13-dimethyl-3-oxo-6-(2-sulfanylacetyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxylate.
| Compound Name | methyl (8S,9R,10R,13S,14S)-10,13-dimethyl-3-oxo-6-(2-sulfanylacetyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 57325303 |
| Molecular Formula | C23H32O4S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | methyl (8S,9R,10R,13S,14S)-10,13-dimethyl-3-oxo-6-(2-sulfanylacetyl)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxylate |
| SMILES | COC(=O)C1C[C@@]2(C)C(=CC1=O)C(C(=O)CS)C[C@@H]1[C@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C23H32O4S/c1-22-7-4-5-16(22)13-9-14(20(25)12-28)18-10-19(24)15(21(26)27-3)11-23(18,2)17(13)6-8-22/h10,13-17,28H,4-9,11-12H2,1-3H3/t13-,14?,15?,16-,17+,22-,23+/m0/s1 |
| InChIKey | HYCCEKYWHSVHIL-VQFCKXHUSA-N |
| XLogP | 4.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|