About N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide
N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide (PubChem CID 57325525) has the molecular formula C18H17N3O4
and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide |
| PubChem CID | 57325525 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide |
| SMILES | COc1nn(-c2ccc(NC(=O)Cc3ccccc3)c(C)c2)c(=O)o1 |
| InChI | InChI=1S/C18H17N3O4/c1-12-10-14(21-18(23)25-17(20-21)24-2)8-9-15(12)19-16(22)11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,19,22) |
| InChIKey | TYRSXXKVBQHZIC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide?
The IUPAC name of N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide (CID 57325525) is N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide.
What is the SMILES notation for N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide?
The canonical SMILES for N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide is COc1nn(-c2ccc(NC(=O)Cc3ccccc3)c(C)c2)c(=O)o1.
What is the InChIKey of N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide?
The InChIKey is TYRSXXKVBQHZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O4/c1-12-10-14(21-18(23)25-17(20-21)24-2)8-9-15(12)19-16(22)11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,19,22).
What are the key properties of N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide?
N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide has a molecular weight of 339.35 g/mol, XLogP of 2.32, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(5-methoxy-2-oxo-1,3,4-oxadiazol-3-yl)-2-methylphenyl]-2-phenylacetamide is sourced from PubChem (CID 57325525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).