C29H32O5 — CID 57325840
5-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1H-indene-2-carboxylic acid (PubChem CID 57325840) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is 5-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1H-indene-2-carboxylic acid.
| Compound Name | 5-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1H-indene-2-carboxylic acid |
|---|---|
| PubChem CID | 57325840 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 5-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1H-indene-2-carboxylic acid |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(COc3ccc4c(c3)CC(C(=O)O)C4)c2)c(C)c1 |
| InChI | InChI=1S/C29H32O5/c1-4-32-10-11-33-27-12-19(2)28(20(3)13-27)23-7-5-6-21(14-23)18-34-26-9-8-22-15-25(29(30)31)16-24(22)17-26/h5-9,12-14,17,25H,4,10-11,15-16,18H2,1-3H3,(H,30,31) |
| InChIKey | UFZFEACIVPSNQS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|