C30H34O5 — CID 57325841
2-[5-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1H-inden-2-yl]acetic acid (PubChem CID 57325841) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is 2-[5-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1H-inden-2-yl]acetic acid.
| Compound Name | 2-[5-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1H-inden-2-yl]acetic acid |
|---|---|
| PubChem CID | 57325841 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 2-[5-[[3-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]phenyl]methoxy]-2,3-dihydro-1H-inden-2-yl]acetic acid |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(COc3ccc4c(c3)CC(CC(=O)O)C4)c2)c(C)c1 |
| InChI | InChI=1S/C30H34O5/c1-4-33-10-11-34-28-12-20(2)30(21(3)13-28)25-7-5-6-22(14-25)19-35-27-9-8-24-15-23(17-29(31)32)16-26(24)18-27/h5-9,12-14,18,23H,4,10-11,15-17,19H2,1-3H3,(H,31,32) |
| InChIKey | DPCOBZIKVOEADX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|