About [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide
[(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide (PubChem CID 57326236) has the molecular formula C21H28INO2
and a molecular weight of 453.36 g/mol. Its IUPAC name is [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide.
Molecular Properties
| Compound Name | [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide |
| PubChem CID | 57326236 |
| Molecular Formula | C21H28INO2 |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)C[C@@H]1COC[C@H](C(c2ccccc2)c2ccccc2)O1.[I-] |
| InChI | InChI=1S/C21H28NO2.HI/c1-22(2,3)14-19-15-23-16-20(24-19)21(17-10-6-4-7-11-17)18-12-8-5-9-13-18;/h4-13,19-21H,14-16H2,1-3H3;1H/q+1;/p-1/t19-,20-;/m1./s1 |
| InChIKey | JHYPVNXUOIYEEE-GZJHNZOKSA-M |
| XLogP | 0.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide?
The IUPAC name of [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide (CID 57326236) is [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide.
What is the SMILES notation for [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide?
The canonical SMILES for [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide is C[N+](C)(C)C[C@@H]1COC[C@H](C(c2ccccc2)c2ccccc2)O1.[I-].
What is the InChIKey of [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide?
The InChIKey is JHYPVNXUOIYEEE-GZJHNZOKSA-M. The full InChI is InChI=1S/C21H28NO2.HI/c1-22(2,3)14-19-15-23-16-20(24-19)21(17-10-6-4-7-11-17)18-12-8-5-9-13-18;/h4-13,19-21H,14-16H2,1-3H3;1H/q+1;/p-1/t19-,20-;/m1./s1.
What are the key properties of [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide?
[(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide has a molecular weight of 453.36 g/mol, XLogP of 0.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,6S)-6-benzhydryl-1,4-dioxan-2-yl]methyl-trimethylazanium iodide is sourced from PubChem (CID 57326236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).