C24H22N4O4S — CID 57326302
N-[(3-imidazo[1,2-a]pyridin-2-ylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 57326302) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[(3-imidazo[1,2-a]pyridin-2-ylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(3-imidazo[1,2-a]pyridin-2-ylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 57326302 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[(3-imidazo[1,2-a]pyridin-2-ylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cccc(-c3cn4ccccc4n3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22N4O4S/c1-30-19-12-16(13-20(31-2)22(19)32-3)23(29)27-24(33)25-17-8-6-7-15(11-17)18-14-28-10-5-4-9-21(28)26-18/h4-14H,1-3H3,(H2,25,27,29,33) |
| InChIKey | DWAVRWHGZVNIKQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|