About 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide
3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide (PubChem CID 57326315) has the molecular formula C20H24BrN3OS
and a molecular weight of 434.40 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide |
| PubChem CID | 57326315 |
| Molecular Formula | C20H24BrN3OS |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide |
| SMILES | Br.CCCCC/N=c1/nc(-c2ccc(OC)cc2)n(-c2ccccc2)s1 |
| InChI | InChI=1S/C20H23N3OS.BrH/c1-3-4-8-15-21-20-22-19(16-11-13-18(24-2)14-12-16)23(25-20)17-9-6-5-7-10-17;/h5-7,9-14H,3-4,8,15H2,1-2H3;1H/b21-20-; |
| InChIKey | VENIWILHBBDHRF-CFRCJOIHSA-N |
| XLogP | 5.28 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide?
The IUPAC name of 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide (CID 57326315) is 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide.
What is the SMILES notation for 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide?
The canonical SMILES for 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide is Br.CCCCC/N=c1/nc(-c2ccc(OC)cc2)n(-c2ccccc2)s1.
What is the InChIKey of 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide?
The InChIKey is VENIWILHBBDHRF-CFRCJOIHSA-N. The full InChI is InChI=1S/C20H23N3OS.BrH/c1-3-4-8-15-21-20-22-19(16-11-13-18(24-2)14-12-16)23(25-20)17-9-6-5-7-10-17;/h5-7,9-14H,3-4,8,15H2,1-2H3;1H/b21-20-;.
What are the key properties of 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide?
3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide has a molecular weight of 434.40 g/mol, XLogP of 5.28, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-N-pentyl-2-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide is sourced from PubChem (CID 57326315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).