C19H23NO2 — CID 57326326
1-[(2S)-6,6-diphenyl-1,4-dioxan-2-yl]-N,N-dimethylmethanamine (PubChem CID 57326326) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[(2S)-6,6-diphenyl-1,4-dioxan-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(2S)-6,6-diphenyl-1,4-dioxan-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 57326326 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[(2S)-6,6-diphenyl-1,4-dioxan-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@H]1COCC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C19H23NO2/c1-20(2)13-18-14-21-15-19(22-18,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | OANBYDFPBWKVGI-SFHVURJKSA-N |
| XLogP | 2.91 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |